EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11Cl2N3O4S2 |
| Net Charge | 0 |
| Average Mass | 360.244 |
| Monoisotopic Mass | 358.95680 |
| SMILES | CN1C(CCl)Nc2cc(Cl)c(S(N)(=O)=O)cc2S1(=O)=O |
| InChI | InChI=1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) |
| InChIKey | CESYKOGBSMNBPD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyclothiazide (CHEBI:6847) has role cardiovascular drug (CHEBI:35554) |
| Methyclothiazide (CHEBI:6847) is a benzothiadiazine (CHEBI:50265) |
| INN | Source |
|---|---|
| meticlotiazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| enduron | DrugCentral |
| methychlothiazide | DrugCentral |
| methyclothiazid | DrugCentral |
| methyclothiazide | DrugCentral |
| Methyclothiazide | KEGG COMPOUND |
| NSC-110431 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aquatensen | ChEMBL |
| Methyclothiazide component of diutensen-r | ChEMBL |
| Methyclothiazide component of enduronyl | ChEMBL |
| Methyclothiazide component of eutron | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1759 | DrugCentral |
| C07765 | KEGG COMPOUND |
| D00656 | KEGG DRUG |
| HMDB0014377 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:135-07-9 | KEGG COMPOUND |
| Citations |
|---|