EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H6NO3)n.C14H15N6O3 |
| Net Charge | -2 |
| Average Mass | 443.420 |
| Monoisotopic Mass | 443.15643 |
| SMILES | Nc1nc2c(c(=O)n1)NC(CNc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1)CN2 |
| InChI | InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t11?,12-/m0/s1 |
| InChIKey | MSTNYGQPCMXVAQ-KIYNQFGBSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrofolyl-poly(L-glutamate) macromolecule (CHEBI:68469) is a tetrahydrofolyl-poly(glutamate) macromolecule (CHEBI:58580) |
| tetrahydrofolyl-poly(L-glutamate) macromolecule (CHEBI:68469) is conjugate base of tetrahydrofolyl-poly(L-glutamic acid) macromolecule (CHEBI:68512) |
| Incoming Relation(s) |
| tetrahydrofolyl-poly(L-glutamate) polymer (CHEBI:68511) has part tetrahydrofolyl-poly(L-glutamate) macromolecule (CHEBI:68469) |
| tetrahydrofolyl-poly(L-glutamic acid) macromolecule (CHEBI:68512) is conjugate acid of tetrahydrofolyl-poly(L-glutamate) macromolecule (CHEBI:68469) |
| UniProt Name | Source |
|---|---|
| tetrahydrofolyl-(L-Glu)n | UniProt |