EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N4O5 |
| Net Charge | 0 |
| Average Mass | 282.256 |
| Monoisotopic Mass | 282.09642 |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(=O)ncnc21 |
| InChI | InChI=1S/C11H14N4O5/c1-19-8-7(17)5(2-16)20-11(8)15-4-14-6-9(15)12-3-13-10(6)18/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | HPHXOIULGYVAKW-IOSLPCCCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-O-methylinosine (CHEBI:68467) has functional parent inosine (CHEBI:17596) |
| 2'-O-methylinosine (CHEBI:68467) has role metabolite (CHEBI:25212) |
| 2'-O-methylinosine (CHEBI:68467) is a inosines (CHEBI:24844) |
| IUPAC Name |
|---|
| 2'-O-methylinosine |
| UniProt Name | Source |
|---|---|
| 2'-O-methylinosine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:562424 | Reaxys |
| Citations |
|---|