EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C(O)c1c(O)cccc1O |
| InChI | InChI=1S/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11) |
| InChIKey | AKEUNCKRJATALU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dihydroxybenzoic acid (CHEBI:68465) has role metabolite (CHEBI:25212) |
| 2,6-dihydroxybenzoic acid (CHEBI:68465) is a dihydroxybenzoic acid (CHEBI:23778) |
| 2,6-dihydroxybenzoic acid (CHEBI:68465) is a monocarboxylic acid (CHEBI:25384) |
| 2,6-dihydroxybenzoic acid (CHEBI:68465) is conjugate acid of 2,6-dihydroxybenzoate (CHEBI:131450) |
| Incoming Relation(s) |
| 2,6-dihydroxybenzoate (CHEBI:131450) is conjugate base of 2,6-dihydroxybenzoic acid (CHEBI:68465) |
| IUPAC Name |
|---|
| 2,6-dihydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 6-Hydroxysalicylic acid | ChemIDplus |
| γ-Resorcylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2,6-Dihydroxybenzoic_acid | Wikipedia |
| CPD-8816 | MetaCyc |
| GRE | PDBeChem |
| HMDB0013676 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209755 | Reaxys |
| CAS:303-07-1 | ChemIDplus |
| Citations |
|---|