EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O2 |
| Net Charge | 0 |
| Average Mass | 286.375 |
| Monoisotopic Mass | 286.16813 |
| SMILES | CN[C@@H](Cc1cnc2cccc(CC=C(C)C)c12)C(=O)O |
| InChI | InChI=1S/C17H22N2O2/c1-11(2)7-8-12-5-4-6-14-16(12)13(10-19-14)9-15(18-3)17(20)21/h4-7,10,15,18-19H,8-9H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | QQMWUGXCTSAHLX-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(3-methylbut-2-enyl)-L-abrine (CHEBI:68464) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| 4-(3-methylbut-2-enyl)-L-abrine (CHEBI:68464) is a L-tryptophan derivative (CHEBI:47994) |
| 4-(3-methylbut-2-enyl)-L-abrine (CHEBI:68464) is tautomer of 4-(3-methylbut-2-enyl)-L-abrine zwitterion (CHEBI:67248) |
| Incoming Relation(s) |
| 4-(3-methylbut-2-enyl)-L-abrine zwitterion (CHEBI:67248) is tautomer of 4-(3-methylbut-2-enyl)-L-abrine (CHEBI:68464) |
| IUPAC Name |
|---|
| N-methyl-4-(3-methylbut-2-en-1-yl)-L-tryptophan |
| Synonym | Source |
|---|---|
| 4-dimethylallyl-L-abrine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12352 | MetaCyc |