EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | Cc1ccccc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H11NO3/c1-7-4-2-3-5-8(7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | YOEBAVRJHRCKRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-methylhippuric acid (CHEBI:68455) has role metabolite (CHEBI:25212) |
| o-methylhippuric acid (CHEBI:68455) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-(2-methylbenzoyl)glycine |
| Synonyms | Source |
|---|---|
| N-(o-Toluoyl)glycine | HMDB |
| 2-methylhippuric acid | ChEBI |
| o-Toluric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011723 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2103944 | Reaxys |
| CAS:42013-20-7 | ChemIDplus |
| Citations |
|---|