EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(NC(O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO4/c11-7(10-8(12)9(13)14)6-4-2-1-3-5-6/h1-5,8,12H,(H,10,11)(H,13,14) |
| InChIKey | GCWCVCCEIQXUQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-hydroxyhippuric acid (CHEBI:68451) has functional parent N-benzoylglycine (CHEBI:18089) |
| α-hydroxyhippuric acid (CHEBI:68451) has role human urinary metabolite (CHEBI:84087) |
| α-hydroxyhippuric acid (CHEBI:68451) is a N-acyl hemiaminal (CHEBI:142734) |
| α-hydroxyhippuric acid (CHEBI:68451) is a N-acyl-amino acid (CHEBI:51569) |
| α-hydroxyhippuric acid (CHEBI:68451) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (benzoylamino)(hydroxy)acetic acid |
| Synonyms | Source |
|---|---|
| 2-benzamidooxyacetic acid | HMDB |
| 2-(Benzoylamino)-2-hydroxyacetic acid | HMDB |
| α-hydroxybenzoylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002404 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2052165 | Reaxys |
| Citations |
|---|