EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C18H24NO4 |
| Net Charge | 0 |
| Average Mass | 398.297 |
| Monoisotopic Mass | 397.08887 |
| SMILES | [Br-].[H][C@]12CC(OC(=O)[C@H](CO)c3ccccc3)C[C@@]([H])(C3OC31)[N+]2(C)C |
| InChI | InChI=1S/C18H24NO4.BrH/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11;/h3-7,12-17,20H,8-10H2,1-2H3;1H/q+1;/p-1/t12?,13-,14+,15+,16?,17?;/m1./s1 |
| InChIKey | CXYRUNPLKGGUJF-JIRGPDKYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methscopolamine bromide (CHEBI:6845) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Methscopolamine bromide | KEGG COMPOUND |
| Pamine (TN) | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00715 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:155-41-9 | KEGG COMPOUND |