EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O3 |
| Net Charge | 0 |
| Average Mass | 196.166 |
| Monoisotopic Mass | 196.05964 |
| SMILES | Cn1c(=O)nc2nc(=O)n(C)c2c1=O |
| InChI | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)9-7(14)11(2)5(3)12/h1-2H3,(H,8,13)(H,9,14) |
| InChIKey | NOFNCLGCUJJPKU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-dimethyluric acid (CHEBI:68449) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 1,7-dimethyluric acid (CHEBI:68449) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,7-dimethyluric acid (CHEBI:68449) has role mouse metabolite (CHEBI:75771) |
| 1,7-dimethyluric acid (CHEBI:68449) is a oxopurine (CHEBI:25810) |
| 1,7-dimethyluric acid (CHEBI:68449) is conjugate acid of 1,7-dimethylurate anion (CHEBI:133727) |
| Incoming Relation(s) |
| 1,7-dimethylurate anion (CHEBI:133727) is conjugate base of 1,7-dimethyluric acid (CHEBI:68449) |
| IUPAC Name |
|---|
| 1,7-dimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Manual Xrefs | Databases |
|---|---|
| CPD-12483 | MetaCyc |
| C16356 | KEGG COMPOUND |
| HMDB0011103 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:219682 | Reaxys |
| CAS:33868-03-0 | ChemIDplus |
| CAS:33868-03-0 | KEGG COMPOUND |
| Citations |
|---|