EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O3 |
| Net Charge | 0 |
| Average Mass | 196.166 |
| Monoisotopic Mass | 196.05964 |
| SMILES | Cn1c(=O)c2nc(=O)nc2n(C)c1=O |
| InChI | InChI=1S/C7H8N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3,(H2,8,9,13) |
| InChIKey | OTSBKHHWSQYEHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dimethyluric acid (CHEBI:68447) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 1,3-dimethyluric acid (CHEBI:68447) has role metabolite (CHEBI:25212) |
| 1,3-dimethyluric acid (CHEBI:68447) is a oxopurine (CHEBI:25810) |
| 1,3-dimethyluric acid (CHEBI:68447) is conjugate acid of 1,3-dimethylurate anion (CHEBI:133726) |
| Incoming Relation(s) |
| 1,3-dimethylurate anion (CHEBI:133726) is conjugate base of 1,3-dimethyluric acid (CHEBI:68447) |
| IUPAC Name |
|---|
| 1,3-dimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Synonym | Source |
|---|---|
| oxytheophylline | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-14118 | MetaCyc |
| HMDB0001857 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:193698 | Reaxys |
| CAS:944-73-0 | ChemIDplus |
| Citations |
|---|