EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N4O3 |
| Net Charge | 0 |
| Average Mass | 182.139 |
| Monoisotopic Mass | 182.04399 |
| SMILES | Cn1c(=O)nc2nc(=O)nc2c1=O |
| InChI | InChI=1S/C6H6N4O3/c1-10-4(11)2-3(9-6(10)13)8-5(12)7-2/h1H3,(H,9,13)(H2,7,8,12) |
| InChIKey | QFDRTQONISXGJA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyluric acid (CHEBI:68441) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 1-methyluric acid (CHEBI:68441) has role human xenobiotic metabolite (CHEBI:76967) |
| 1-methyluric acid (CHEBI:68441) has role mouse metabolite (CHEBI:75771) |
| 1-methyluric acid (CHEBI:68441) is a oxopurine (CHEBI:25810) |
| 1-methyluric acid (CHEBI:68441) is conjugate acid of 1-methylurate anion (CHEBI:133725) |
| Incoming Relation(s) |
| 1-methylurate anion (CHEBI:133725) is conjugate base of 1-methyluric acid (CHEBI:68441) |
| IUPAC Name |
|---|
| 1-methyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Manual Xrefs | Databases |
|---|---|
| C16359 | KEGG COMPOUND |
| CPD-14119 | MetaCyc |
| HMDB0003099 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:195190 | Reaxys |
| CAS:708-79-2 | ChemIDplus |
| CAS:708-79-2 | KEGG COMPOUND |
| Citations |
|---|