EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O |
| Net Charge | 0 |
| Average Mass | 136.154 |
| Monoisotopic Mass | 136.06366 |
| SMILES | Cc1ncccc1C(N)=O |
| InChI | InChI=1S/C7H8N2O/c1-5-6(7(8)10)3-2-4-9-5/h2-4H,1H3,(H2,8,10) |
| InChIKey | JRYYVMDEUJQWRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylnicotinamide (CHEBI:68440) has functional parent nicotinamide (CHEBI:17154) |
| 2-methylnicotinamide (CHEBI:68440) has role metabolite (CHEBI:25212) |
| 2-methylnicotinamide (CHEBI:68440) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| 2-methylpyridine-3-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:114378 | Reaxys |
| Citations |
|---|