EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O4 |
| Net Charge | 0 |
| Average Mass | 416.602 |
| Monoisotopic Mass | 416.29266 |
| SMILES | [H][C@]12CC(=O)O[C@@]1(C)C[C@](C)(CCCCCCCCCCCCc1ccc(O)cc1)O2 |
| InChI | InChI=1S/C26H40O4/c1-25(20-26(2)23(29-25)19-24(28)30-26)18-12-10-8-6-4-3-5-7-9-11-13-21-14-16-22(27)17-15-21/h14-17,23,27H,3-13,18-20H2,1-2H3/t23-,25-,26-/m0/s1 |
| InChIKey | AVPPXTVRSKQLNJ-RNXOBYDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakinastrella clathrata (WORMS:169753) | - | PubMed (21261297) | CH2Cl2/MeOH (1:1) extract of diced specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plakortone N (CHEBI:68421) has role metabolite (CHEBI:25212) |
| plakortone N (CHEBI:68421) is a organic heterobicyclic compound (CHEBI:27171) |
| plakortone N (CHEBI:68421) is a phenols (CHEBI:33853) |
| plakortone N (CHEBI:68421) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,5S,6aS)-5-[12-(4-hydroxyphenyl)dodecyl]-5,6a-dimethyltetrahydrofuro[3,2-b]furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21309212 | Reaxys |
| Citations |
|---|