EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15Cl3O2 |
| Net Charge | 0 |
| Average Mass | 345.653 |
| Monoisotopic Mass | 344.01376 |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3O2/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12/h3-10,15H,1-2H3 |
| InChIKey | IAKOZHOLGAGEJT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxychlor (CHEBI:6842) has functional parent 1,1,1-trichloro-2,2-diphenylethane (CHEBI:39161) |
| methoxychlor (CHEBI:6842) is a organochlorine insecticide (CHEBI:25705) |
| IUPAC Name |
|---|
| 1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-methoxybenzene) |
| Synonyms | Source |
|---|---|
| 1,1,1-trichloro-2,2-bis(p-anisyl)ethane | NIST Chemistry WebBook |
| 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)ethane | NIST Chemistry WebBook |
| 1,1,1-trichloro-2,2-di(4-methoxyphenyl)ethane | NIST Chemistry WebBook |
| 2,2-bis(p-anisyl)-1,1,1-trichloroethane | ChemIDplus |
| 2,2-bis(p-methoxyphenyl)-1,1,1-trichloroethane | ChemIDplus |
| 2,2-di(p-methoxyphenyl)-1,1,1-trichloroethane | NIST Chemistry WebBook |