EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4 |
| Net Charge | 0 |
| Average Mass | 384.516 |
| Monoisotopic Mass | 384.23006 |
| SMILES | [H][C@@]12CC(=O)O[C@]1(C)C[C@](C)(CCCCCC/C=C/C=C/c1ccccc1)OO2 |
| InChI | InChI=1S/C24H32O4/c1-23(19-24(2)21(27-28-23)18-22(25)26-24)17-13-8-6-4-3-5-7-10-14-20-15-11-9-12-16-20/h5,7,9-12,14-16,21H,3-4,6,8,13,17-19H2,1-2H3/b7-5+,14-10+/t21-,23+,24-/m1/s1 |
| InChIKey | VIBYZHWNCSGZMC-GKFAJYMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakinastrella clathrata (WORMS:169753) | - | PubMed (21261297) | CH2Cl2/MeOH (1:1) extract of diced specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plakortolide Q (CHEBI:68414) has role metabolite (CHEBI:25212) |
| plakortolide Q (CHEBI:68414) is a organic heterobicyclic compound (CHEBI:27171) |
| plakortolide Q (CHEBI:68414) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,4aR,7aR)-3,4a-dimethyl-3-[(7E,9E)-10-phenyldeca-7,9-dien-1-yl]tetrahydrofuro[3,2-c][1,2]dioxin-6(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21309196 | Reaxys |
| Citations |
|---|