EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O4 |
| Net Charge | 0 |
| Average Mass | 412.570 |
| Monoisotopic Mass | 412.26136 |
| SMILES | [H][C@]12CC(=O)O[C@@]1(C)C[C@](C)(CCCCCCCC/C=C/C=C/c1ccccc1)OO2 |
| InChI | InChI=1S/C26H36O4/c1-25(21-26(2)23(29-30-25)20-24(27)28-26)19-15-10-8-6-4-3-5-7-9-12-16-22-17-13-11-14-18-22/h7,9,11-14,16-18,23H,3-6,8,10,15,19-21H2,1-2H3/b9-7+,16-12+/t23-,25-,26-/m0/s1 |
| InChIKey | KEKDEOVVWKTZKA-NZGJWSFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plakinastrella clathrata (WORMS:169753) | - | PubMed (21261297) | CH2Cl2/MeOH (1:1) extract of diced specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plakortolide P (CHEBI:68413) has role metabolite (CHEBI:25212) |
| plakortolide P (CHEBI:68413) is a organic heterobicyclic compound (CHEBI:27171) |
| plakortolide P (CHEBI:68413) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,4aS,7aS)-3,4a-dimethyl-3-[(9E,11E)-12-phenyldodeca-9,11-dien-1-yl]tetrahydrofuro[3,2-c][1,2]dioxin-6(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21309200 | Reaxys |
| Citations |
|---|