EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | COc1ccc2c(c1O)[C@]13CCN(C)[C@](O)(C1)C(=O)C=C3C=C2 |
| InChI | InChI=1S/C18H19NO4/c1-19-8-7-17-10-18(19,22)14(20)9-12(17)5-3-11-4-6-13(23-2)16(21)15(11)17/h3-6,9,21-22H,7-8,10H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | KDYWOWVAVXEYRU-MSOLQXFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stephania cephalantha (ncbitaxon:152367) | |||
| leaf (BTO:0000713) | PubMed (21214233) | 95% aqueous EtOH extract of dried and powdered leaves ans stems | |
| stem (BTO:0001300) | PubMed (21214233) | 95% aqueous EtOH extract of dried and powdered leaves ans stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cepharatine A, (rel)- (CHEBI:68399) has role metabolite (CHEBI:25212) |
| Cepharatine A, (rel)- (CHEBI:68399) is a phenanthrenes (CHEBI:25961) |
| Citations |
|---|