EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O |
| Net Charge | 0 |
| Average Mass | 380.616 |
| Monoisotopic Mass | 380.30792 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/CC(C)C |
| InChI | InChI=1S/C27H40O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h6,8,13,15,17-19,22-25H,7,9-12,14,16H2,1-5H3/b8-6+/t19-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | AJWONNNXQUONDT-UAJHHUEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholesta-1,4,22-trien-3-one (CHEBI:68398) has role metabolite (CHEBI:25212) |
| cholesta-1,4,22-trien-3-one (CHEBI:68398) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| cholesta-1,4,22-trien-3-one (CHEBI:68398) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cholesta-1,4,22-trien-3-one (CHEBI:68398) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| (22E)-cholesta-1,4,22-trien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306701 | Reaxys |
| Citations |
|---|