EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O |
| Net Charge | 0 |
| Average Mass | 368.605 |
| Monoisotopic Mass | 368.30792 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C26H40O/c1-17(2)6-5-7-18(3)24-12-13-25-23-10-8-19-16-20(27)9-11-21(19)22(23)14-15-26(24,25)4/h9,11,16-18,22-25,27H,5-8,10,12-15H2,1-4H3/t18-,22-,23-,24-,25+,26-/m1/s1 |
| InChIKey | HIGFJBWLJMUGFT-XTNBKHNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-norcholesta-1,3,5(10)-trien-3-ol (CHEBI:68397) has role coral metabolite (CHEBI:76498) |
| 19-norcholesta-1,3,5(10)-trien-3-ol (CHEBI:68397) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (17β)-17-[(2R)-6-methylheptan-2-yl]estra-1,3,5(10)-trien-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3159805 | Reaxys |
| Citations |
|---|