EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O |
| Net Charge | 0 |
| Average Mass | 366.589 |
| Monoisotopic Mass | 366.29227 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/C(C)C |
| InChI | InChI=1S/C26H38O/c1-17(2)6-7-18(3)22-10-11-23-21-9-8-19-16-20(27)12-14-25(19,4)24(21)13-15-26(22,23)5/h6-7,12,14,16-18,21-24H,8-11,13,15H2,1-5H3/b7-6+/t18-,21+,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | JSHASXVESQAJJO-MZXJRKPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22E)-24nor-cholesta-1,4,22-trien-3-one (CHEBI:68396) has role coral metabolite (CHEBI:76498) |
| (22E)-24nor-cholesta-1,4,22-trien-3-one (CHEBI:68396) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306702 | Reaxys |
| Citations |
|---|