EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O |
| Net Charge | 0 |
| Average Mass | 394.643 |
| Monoisotopic Mass | 394.32357 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=C)C(C)C |
| InChI | InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h13,15,17-18,20,23-26H,3,7-12,14,16H2,1-2,4-6H3/t20-,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | UVAVWWCPGAHKIW-QVMRCSLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylenecholesta-1,4-dien-3-one (CHEBI:68395) has role coral metabolite (CHEBI:76498) |
| 24-methylenecholesta-1,4-dien-3-one (CHEBI:68395) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| 24-methylenecholesta-1,4-dien-3-one (CHEBI:68395) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| ergosta-1,4,24(28)-trien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306709 | Reaxys |
| Citations |
|---|