EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O |
| Net Charge | 0 |
| Average Mass | 380.616 |
| Monoisotopic Mass | 380.30792 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C27H40O/c1-17(2)18(3)6-7-19(4)25-12-13-26-24-10-8-20-16-21(28)9-11-22(20)23(24)14-15-27(25,26)5/h9,11,16-17,19,23-26,28H,3,6-8,10,12-15H2,1-2,4-5H3/t19-,23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | WURDLURTNDQONP-WQGNMAKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylene-19-norcholesta-1,3,5(10)-trien-3-ol (CHEBI:68392) has role coral metabolite (CHEBI:76498) |
| 24-methylene-19-norcholesta-1,3,5(10)-trien-3-ol (CHEBI:68392) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (17β)-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]estra-1,3,5(10)-trien-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306708 | Reaxys |
| Citations |
|---|