EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO3 |
| Net Charge | 0 |
| Average Mass | 211.261 |
| Monoisotopic Mass | 211.12084 |
| SMILES | COc1ccc(OC)c(C(O)C(C)N)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(12)11(13)9-6-8(14-2)4-5-10(9)15-3/h4-7,11,13H,12H2,1-3H3 |
| InChIKey | WJAJPNHVVFWKKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | antihypotensive agent A cardiovascular drug that tends to raise reduced blood pressure. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxamine (CHEBI:6839) has role antihypotensive agent (CHEBI:137431) |
| methoxamine (CHEBI:6839) has role α-adrenergic agonist (CHEBI:35569) |
| methoxamine (CHEBI:6839) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| methoxamedrine | ChEBI |
| methoxamin | DrugCentral |
| Methoxamine | KEGG COMPOUND |
| Citations |
|---|