EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:6839 - methoxamine
| Formula | C11H17NO3 |
| Net Charge | 0 |
| Average Mass | 211.261 |
| Monoisotopic Mass | 211.12084 |
| SMILES | COc1ccc(OC)c(C(O)C(C)N)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(12)11(13)9-6-8(14-2)4-5-10(9)15-3/h4-7,11,13H,12H2,1-3H3 |
| InChIKey | WJAJPNHVVFWKKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antihypotensive agent A cardiovascular drug that tends to raise reduced blood pressure. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxamine (CHEBI:6839) has role antihypotensive agent (CHEBI:137431) |
| methoxamine (CHEBI:6839) has role cardiovascular drug (CHEBI:35554) |
| methoxamine (CHEBI:6839) has role α-adrenergic agonist (CHEBI:35569) |
| methoxamine (CHEBI:6839) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| metoxamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| methoxamedrine | ChEBI |
| methoxamin | DrugCentral |
| Methoxamine | KEGG COMPOUND |
| NRL-001 | ChEMBL |
| NRL001 | ChEMBL |
| Citations |
|---|