EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@@H](CCCC(C)C)C(=O)OC)[C@@]4(C)CC[C@]3([H])[C@@]1(C)C=CC(=O)C2 |
| InChI | InChI=1S/C28H44O3/c1-18(2)7-6-8-22(26(30)31-5)24-12-11-23-21-10-9-19-17-20(29)13-15-27(19,3)25(21)14-16-28(23,24)4/h13,15,18-19,21-25H,6-12,14,16-17H2,1-5H3/t19-,21-,22+,23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | LTTLIRHGLXHJJP-CNMDJWEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendronephthya studeri (WORMS:289144) | - | PubMed (21192715) | Diethylether soluble extract of frozen soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl spongoate (CHEBI:68388) has parent hydride 5α-cholestane (CHEBI:35515) |
| methyl spongoate (CHEBI:68388) has role coral metabolite (CHEBI:76498) |
| methyl spongoate (CHEBI:68388) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| methyl spongoate (CHEBI:68388) is a cholestanoid (CHEBI:50401) |
| methyl spongoate (CHEBI:68388) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| methyl (5α)-3-oxocholest-1-en-21-oate |
| Synonym | Source |
|---|---|
| cholest-1-en-3-on-20(R)-oic acid methyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11040719 | Reaxys |
| Citations |
|---|