EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@@]12C(=O)CC[C@@]3(C=CC[C@H](C)[C@]31C)O[C@H](O)[C@H]2C |
| InChI | InChI=1S/C15H22O3/c1-9-5-4-7-15-8-6-11(16)12(14(9,15)3)10(2)13(17)18-15/h4,7,9-10,12-13,17H,5-6,8H2,1-3H3/t9-,10-,12+,13-,14-,15+/m0/s1 |
| InChIKey | FWWRXBATPXVGGD-KXPNOOGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lemnalia flava (WORMS:288046) | - | PubMed (21204521) | EtOAc extract of frozen, minced soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavalin B (CHEBI:68385) has role coral metabolite (CHEBI:76498) |
| flavalin B (CHEBI:68385) has role neuroprotective agent (CHEBI:63726) |
| flavalin B (CHEBI:68385) is a cyclic ether (CHEBI:37407) |
| flavalin B (CHEBI:68385) is a cyclic ketone (CHEBI:3992) |
| flavalin B (CHEBI:68385) is a organic heterotricyclic compound (CHEBI:26979) |
| flavalin B (CHEBI:68385) is a secondary alcohol (CHEBI:35681) |
| flavalin B (CHEBI:68385) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1S*,4aS*,8S*,8aS*,10S*,11S*)-10-hydroxy-8,8a,11-trimethyl-1,3,4,7,8,8a-hexahydro-2H-4a,1-(epoxyethano)naphthalen-2-one |
| Synonym | Source |
|---|---|
| rel-(1S,4aS,8S,8aS,10S,11S)-10-hydroxy-8,8a,11-trimethyl-1,3,4,7,8,8a-hexahydro-2H-4a,1-(epoxyethano)naphthalen-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306700 | Reaxys |
| Citations |
|---|