EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | [H][C@@]12O[C@@]34C=CC[C@H](C)[C@@]3(C)[C@]([H])([C@@H]1C)[C@]([H])(CC4)O2 |
| InChI | InChI=1S/C15H22O2/c1-9-5-4-7-15-8-6-11-12(14(9,15)3)10(2)13(16-11)17-15/h4,7,9-13H,5-6,8H2,1-3H3/t9-,10-,11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | GTARSQGFXOXFHP-DJIVWJMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lemnalia flava (WORMS:288046) | - | PubMed (21204521) | EtOAc extract of frozen, minced soft coral |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavalin A (CHEBI:68384) has role anti-inflammatory agent (CHEBI:67079) |
| flavalin A (CHEBI:68384) has role coral metabolite (CHEBI:76498) |
| flavalin A (CHEBI:68384) has role neuroprotective agent (CHEBI:63726) |
| flavalin A (CHEBI:68384) is a cyclic ether (CHEBI:37407) |
| flavalin A (CHEBI:68384) is a organic heterotetracyclic compound (CHEBI:38163) |
| flavalin A (CHEBI:68384) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1S*,2R*,3aS*,5aS,9S*,9aS*,9bS*)-1,9,9a-trimethyl-1,2,4,5,8,9,9a,9b-octahydro-3aH-2,5a-epoxynaphtho[2,1-b]furan |
| Synonym | Source |
|---|---|
| rel-(1S,5S,6S,7S,8S,9R,11S)-5,6,8-trimethyl-10,14-dioxatetracyclo[7.4.1.01,6.07,11]tetradec-2-ene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306697 | Reaxys |
| Citations |
|---|