EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])([C@H](O)C=C4[C@@]3(C)CC[C@@]3(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]43[H])[C@@]1(C)C[C@@H](O)[C@H](O)[C@@]2(C)CO |
| InChI | InChI=1S/C30H48O6/c1-16-7-10-30(25(35)36)12-11-28(5)18(22(30)17(16)2)13-19(32)23-26(3)14-20(33)24(34)27(4,15-31)21(26)8-9-29(23,28)6/h13,16-17,19-24,31-34H,7-12,14-15H2,1-6H3,(H,35,36)/t16-,17+,19-,20-,21-,22+,23-,24+,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | FFPKNVKIBUBHMY-CCEBUSCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has functional parent asiatic acid (CHEBI:2873) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has parent hydride ursane (CHEBI:35711) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has role antibacterial agent (CHEBI:33282) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has role metabolite (CHEBI:25212) |
| 11α-hydroxyasiatic acid (CHEBI:68380) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 11α-hydroxyasiatic acid (CHEBI:68380) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2α,3β,11α)-2,3,11,23-tetrahydroxyurs-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306691 | Reaxys |
| Citations |
|---|