EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])([C@H](O)C=C4[C@@]3(C)CC[C@@]3(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]43[H])[C@@]1(C)C[C@@H](O)[C@H](O)[C@@]2(C)CO |
| InChI | InChI=1S/C30H48O6/c1-16-7-10-30(25(35)36)12-11-28(5)18(22(30)17(16)2)13-19(32)23-26(3)14-20(33)24(34)27(4,15-31)21(26)8-9-29(23,28)6/h13,16-17,19-24,31-34H,7-12,14-15H2,1-6H3,(H,35,36)/t16-,17+,19-,20-,21-,22+,23-,24+,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | FFPKNVKIBUBHMY-CCEBUSCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has functional parent asiatic acid (CHEBI:2873) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has parent hydride ursane (CHEBI:35711) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has role antibacterial agent (CHEBI:33282) |
| 11α-hydroxyasiatic acid (CHEBI:68380) has role metabolite (CHEBI:25212) |
| 11α-hydroxyasiatic acid (CHEBI:68380) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 11α-hydroxyasiatic acid (CHEBI:68380) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2α,3β,11α)-2,3,11,23-tetrahydroxyurs-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21306691 | Reaxys |
| Citations |
|---|