EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2OS |
| Net Charge | 0 |
| Average Mass | 328.481 |
| Monoisotopic Mass | 328.16093 |
| SMILES | COc1ccc2c(c1)N(C[C@H](C)CN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | VRQVVMDWGGWHTJ-CQSZACIVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methotrimeprazine (CHEBI:6838) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| methotrimeprazine (CHEBI:6838) has role anticoronaviral agent (CHEBI:149553) |
| methotrimeprazine (CHEBI:6838) has role cholinergic antagonist (CHEBI:48873) |
| methotrimeprazine (CHEBI:6838) has role dopaminergic antagonist (CHEBI:48561) |
| methotrimeprazine (CHEBI:6838) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| methotrimeprazine (CHEBI:6838) has role non-narcotic analgesic (CHEBI:35481) |
| methotrimeprazine (CHEBI:6838) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| methotrimeprazine (CHEBI:6838) has role serotonergic antagonist (CHEBI:48279) |
| methotrimeprazine (CHEBI:6838) is a phenothiazines (CHEBI:38093) |
| methotrimeprazine (CHEBI:6838) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| INNs | Source |
|---|---|
| levomepromazina | ChEBI |
| levomepromazine | WHO MedNet |
| lévomépromazine | ChEBI |
| levomepromazinum | ChEBI |
| Synonyms | Source |
|---|---|
| (-)-10-(3-(Dimethylamino)-2-methylpropyl)-2-methoxyphenothiazine | ChemIDplus |
| (-)-(2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine | ChemIDplus |
| 2-Methoxytrimeprazine | ChemIDplus |
| Levomepromazine | KEGG COMPOUND |
| Methotrimeprazine | KEGG COMPOUND |
| Citations |
|---|