EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50O15 |
| Net Charge | 0 |
| Average Mass | 770.825 |
| Monoisotopic Mass | 770.31497 |
| SMILES | [H][C@]12CC[C@]3(C)C(=C1[C@H](OC(C)=O)[C@@]1(O)[C@@H](OC(=O)/C(C)=C/C)[C@@]4(C)C[C@@]1(OC(C)=O)[C@@]2(C)[C@H]4CC(=O)OC)[C@@H](OC(=O)C(C)(C)O)C(=O)O[C@H]3c1ccoc1 |
| InChI | InChI=1S/C40H50O15/c1-11-19(2)31(44)54-33-37(8)18-39(55-21(4)42)38(9,24(37)16-25(43)49-10)23-12-14-36(7)27(26(23)30(40(33,39)48)51-20(3)41)28(52-34(46)35(5,6)47)32(45)53-29(36)22-13-15-50-17-22/h11,13,15,17,23-24,28-30,33,47-48H,12,14,16,18H2,1-10H3/b19-11+/t23-,24-,28+,29-,30-,33-,36+,37-,38+,39+,40+/m0/s1 |
| InChIKey | VMLJBDMMPGMLSB-JEJLXXDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichilia connaroides (IPNI:579388-1) | leaf (BTO:0000713) | PubMed (21268637) | Methanolic extract of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) has functional parent 2-hydroxyisobutyric acid (CHEBI:50129) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) has functional parent tiglic acid (CHEBI:9592) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) has functional parent trichagmalin F (CHEBI:68367) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) has role plant metabolite (CHEBI:76924) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a acetate ester (CHEBI:47622) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a bridged compound (CHEBI:35990) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a furans (CHEBI:24129) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a limonoid (CHEBI:39434) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a methyl ester (CHEBI:25248) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a organic heteropentacyclic compound (CHEBI:38164) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a secondary alcohol (CHEBI:35681) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a tertiary alcohol (CHEBI:26878) |
| 1,30-diacetyltrichagmalin F (CHEBI:68369) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1R,4R,5S,6S,6aR,8S,9S,9aS,9bS,11aR,12S)-5,6a-bis(acetyloxy)-1-(furan-3-yl)-6-hydroxy-4-[(2-hydroxy-2-methylpropanoyl)oxy]-9-(2-methoxy-2-oxoethyl)-8,9a,11a-trimethyl-3-oxo-1,3,4,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-6,8-methanoindeno[5,4-f]isochromen-12-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21299048 | Reaxys |
| Citations |
|---|