EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48O15 |
| Net Charge | 0 |
| Average Mass | 768.809 |
| Monoisotopic Mass | 768.29932 |
| SMILES | [H][C@]12CC[C@]3(C)C(=C1[C@H](OC(C)=O)[C@@]1(OC(C)=O)[C@@H](OC(=O)/C(C)=C/C)[C@@]4(C)C[C@@]1(OC(C)=O)[C@@]2(C)[C@H]4CC(=O)OC)[C@@H](OC(C)=O)C(=O)O[C@H]3c1ccoc1 |
| InChI | InChI=1S/C40H48O15/c1-11-19(2)33(46)53-35-37(8)18-39(54-22(5)43)38(9,26(37)16-27(45)48-10)25-12-14-36(7)29(28(25)32(51-21(4)42)40(35,39)55-23(6)44)30(50-20(3)41)34(47)52-31(36)24-13-15-49-17-24/h11,13,15,17,25-26,30-32,35H,12,14,16,18H2,1-10H3/b19-11+/t25-,26-,30+,31-,32-,35-,36+,37-,38+,39+,40+/m0/s1 |
| InChIKey | JPEOURBMRMLICN-POSMAMQXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichilia connaroides (IPNI:579388-1) | leaf (BTO:0000713) | PubMed (21268637) | Methanolic extract of air-dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-acetyltrichagmalin E (CHEBI:68366) has functional parent tiglic acid (CHEBI:9592) |
| 15-acetyltrichagmalin E (CHEBI:68366) has functional parent trichagmalin E (CHEBI:68365) |
| 15-acetyltrichagmalin E (CHEBI:68366) has role plant metabolite (CHEBI:76924) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a acetate ester (CHEBI:47622) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a bridged compound (CHEBI:35990) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a furans (CHEBI:24129) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a limonoid (CHEBI:39434) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a methyl ester (CHEBI:25248) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a organic heteropentacyclic compound (CHEBI:38164) |
| 15-acetyltrichagmalin E (CHEBI:68366) is a δ-lactone (CHEBI:18946) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23636717 | Reaxys |
| Citations |
|---|