EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O3 |
| Net Charge | 0 |
| Average Mass | 468.722 |
| Monoisotopic Mass | 468.36035 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@@H](CCC(=C)C(C)C)C(=O)O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C31H48O3/c1-19(2)20(3)9-10-21(27(33)34)22-13-17-31(8)24-11-12-25-28(4,5)26(32)15-16-29(25,6)23(24)14-18-30(22,31)7/h19,21-22,25H,3,9-18H2,1-2,4-8H3,(H,33,34)/t21-,22-,25+,29-,30-,31+/m1/s1 |
| InChIKey | KBZOWVQYHZLSSX-DIQRFASRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poria cocos (ncbitaxon:87299) | sclerotium (BTO:0001810) | PubMed (21250700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroeburiconic acid (CHEBI:68358) has parent hydride lanostane (CHEBI:20265) |
| dehydroeburiconic acid (CHEBI:68358) has role fungal metabolite (CHEBI:76946) |
| dehydroeburiconic acid (CHEBI:68358) is a cyclic terpene ketone (CHEBI:36130) |
| dehydroeburiconic acid (CHEBI:68358) is a monocarboxylic acid (CHEBI:25384) |
| dehydroeburiconic acid (CHEBI:68358) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| 24-methylidene-3-oxolanost-8-en-21-oic acid |
| Synonym | Source |
|---|---|
| fomefficinic acid A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3179399 | Reaxys |
| Citations |
|---|