EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O5 |
| Net Charge | 0 |
| Average Mass | 500.720 |
| Monoisotopic Mass | 500.35017 |
| SMILES | [H][C@]1([C@@H](CCC(=C)C(C)(C)O)C(=O)O)[C@H](O)C[C@@]2(C)C3=CC[C@@]4([H])C(C)(C)[C@H](O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C31H48O5/c1-18(28(4,5)36)9-10-19(26(34)35)25-22(32)17-31(8)21-11-12-23-27(2,3)24(33)14-15-29(23,6)20(21)13-16-30(25,31)7/h11,13,19,22-25,32-33,36H,1,9-10,12,14-17H2,2-8H3,(H,34,35)/t19-,22-,23+,24-,25+,29-,30-,31+/m1/s1 |
| InChIKey | GDIGQYHXIOMOQU-NEAGZGJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poria cocos (ncbitaxon:87299) | sclerotium (BTO:0001810) | PubMed (21250700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) has parent hydride lanostane (CHEBI:20265) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) has role fungal metabolite (CHEBI:76946) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) is a monocarboxylic acid (CHEBI:25384) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) is a secondary alcohol (CHEBI:35681) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) is a tertiary alcohol (CHEBI:26878) |
| 25-hydroxy-3-epidehydrotumulosic acid (CHEBI:68357) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3α,16α)-3,16,25-trihydroxy-24-methylidenelanosta-7,9(11)-dien-21-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7319170 | Reaxys |
| Citations |
|---|