EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O5 |
| Net Charge | 0 |
| Average Mass | 500.720 |
| Monoisotopic Mass | 500.35017 |
| SMILES | [H][C@]1([C@@H](CCC(=C)C(C)C)C(=O)O)[C@H](O)C[C@@]2(C)C3=C(CC[C@]12C)[C@@](C)(CCC(=O)O)[C@H](C(=C)C)CC3 |
| InChI | InChI=1S/C31H48O5/c1-18(2)20(5)9-10-21(28(35)36)27-25(32)17-31(8)24-12-11-22(19(3)4)29(6,15-14-26(33)34)23(24)13-16-30(27,31)7/h18,21-22,25,27,32H,3,5,9-17H2,1-2,4,6-8H3,(H,33,34)(H,35,36)/t21-,22+,25-,27+,29+,30-,31+/m1/s1 |
| InChIKey | GKXXWKRLARTIQL-SMFZDKLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poria cocos (ncbitaxon:87299) | sclerotium (BTO:0001810) | PubMed (21250700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poricoic acid H (CHEBI:68356) has role fungal metabolite (CHEBI:76946) |
| poricoic acid H (CHEBI:68356) is a dicarboxylic acid (CHEBI:35692) |
| poricoic acid H (CHEBI:68356) is a secondary alcohol (CHEBI:35681) |
| poricoic acid H (CHEBI:68356) is a tricyclic triterpenoid (CHEBI:52340) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,5,6,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9175534 | Reaxys |
| Citations |
|---|