EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]1([C@@H](CCC=C(C)C)C(=O)O)[C@H](O)C[C@@]2(C)C3=C(CC[C@]12C)[C@@](C)(CCC(=O)O)[C@H](C(=C)C)CC3 |
| InChI | InChI=1S/C30H46O5/c1-18(2)9-8-10-20(27(34)35)26-24(31)17-30(7)23-12-11-21(19(3)4)28(5,15-14-25(32)33)22(23)13-16-29(26,30)6/h9,20-21,24,26,31H,3,8,10-17H2,1-2,4-7H3,(H,32,33)(H,34,35)/t20-,21+,24-,26+,28+,29-,30+/m1/s1 |
| InChIKey | VPTZOSBKEDUOFE-KXGBKNTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poria cocos (ncbitaxon:87299) | sclerotium (BTO:0001810) | PubMed (21250700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poricoic acid G (CHEBI:68355) has role fungal metabolite (CHEBI:76946) |
| poricoic acid G (CHEBI:68355) is a dicarboxylic acid (CHEBI:35692) |
| poricoic acid G (CHEBI:68355) is a secondary alcohol (CHEBI:35681) |
| poricoic acid G (CHEBI:68355) is a tricyclic triterpenoid (CHEBI:52340) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,5,6,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl]-6-methylhept-5-enoic acid |
| Synonym | Source |
|---|---|
| 16α-hydroxy-3,4-seco-lanosta-4(28),8,24-triene-3,21-dioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9174362 | Reaxys |
| Citations |
|---|