EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O4 |
| Net Charge | 0 |
| Average Mass | 482.705 |
| Monoisotopic Mass | 482.33961 |
| SMILES | [H][C@]1([C@@H](CCC(=C)C(C)C)C(=O)O)CC[C@@]2(C)C3=CC[C@@H](C(=C)C)[C@](C)(CCC(=O)O)C3=CC[C@@]21C |
| InChI | InChI=1S/C31H46O4/c1-19(2)21(5)9-10-22(28(34)35)24-13-17-31(8)26-12-11-23(20(3)4)29(6,16-15-27(32)33)25(26)14-18-30(24,31)7/h12,14,19,22-24H,3,5,9-11,13,15-18H2,1-2,4,6-8H3,(H,32,33)(H,34,35)/t22-,23+,24-,29+,30-,31+/m1/s1 |
| InChIKey | QFVFCBZDUKVXLR-PKSIZLAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poria cocos (ncbitaxon:87299) | sclerotium (BTO:0001810) | PubMed (21250700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poricoic acid C (CHEBI:68354) has role fungal metabolite (CHEBI:76946) |
| poricoic acid C (CHEBI:68354) is a dicarboxylic acid (CHEBI:35692) |
| poricoic acid C (CHEBI:68354) is a tricyclic triterpenoid (CHEBI:52340) |
| IUPAC Name |
|---|
| (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,6,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195378 | Reaxys |
| Citations |
|---|