EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
| InChIKey | OVSQVDMCBVZWGM-QSOFNFLRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Vitis vinifera (ncbitaxon:29760) | |||
| - | MetaboLights (MTBLS55) | ||
| - | DOI (10.1007/s11306-014-0638-x) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. osteogenesis regulator Any compound that induces or regulates osteogenesis. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has functional parent β-D-glucose (CHEBI:15903) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role antineoplastic agent (CHEBI:35610) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role antioxidant (CHEBI:22586) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role antipruritic drug (CHEBI:59683) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role bone density conservation agent (CHEBI:50646) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role geroprotector (CHEBI:176497) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role histamine antagonist (CHEBI:37956) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role osteogenesis regulator (CHEBI:63054) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) has role plant metabolite (CHEBI:76924) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) is a monosaccharide derivative (CHEBI:63367) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) is a quercetin O-glucoside (CHEBI:64621) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) is a tetrahydroxyflavone (CHEBI:38684) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) is a β-D-glucoside (CHEBI:22798) |
| quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) is conjugate acid of quercetin 3-O-β-D-glucopyranoside(1−) (CHEBI:144437) |
| Incoming Relation(s) |
| quercetin 3-O-β-D-glucopyranoside(1−) (CHEBI:144437) is conjugate base of quercetin 3-O-β-D-glucopyranoside (CHEBI:68352) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-(3,4-Dihidroxyphenyl)-3-(beta-D-glucofuranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one | KEGG COMPOUND |
| 2-(3,4-dihydroxyphenyl)-3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |
| isoquercetin | ChEBI |
| Isoquercitrin | KEGG COMPOUND |
| Isotrifoliin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00005373 | KNApSAcK |
| C05623 | KEGG COMPOUND |
| HMDB0037362 | HMDB |
| HW2 | PDBeChem |
| Isoquercetin | Wikipedia |
| LSM-5818 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100989 | Reaxys |
| CAS:21637-25-2 | KEGG COMPOUND |
| CAS:482-35-9 | ChemIDplus |
| Citations |
|---|