EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6835 - methomyl
| Formula | C5H10N2O2S |
| Net Charge | 0 |
| Average Mass | 162.214 |
| Monoisotopic Mass | 162.04630 |
| SMILES | CNC(=O)ON=C(C)SC |
| InChI | InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8) |
| InChIKey | UHXUZOCRWCRNSJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methomyl (CHEBI:6835) has functional parent 1-(methylsulfanyl)acetaldoxime (CHEBI:38534) |
| methomyl (CHEBI:6835) has functional parent methylcarbamic acid (CHEBI:45379) |
| methomyl (CHEBI:6835) has role acaricide (CHEBI:22153) |
| methomyl (CHEBI:6835) has role agrochemical (CHEBI:33286) |
| methomyl (CHEBI:6835) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| methomyl (CHEBI:6835) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| methomyl (CHEBI:6835) has role environmental contaminant (CHEBI:78298) |
| methomyl (CHEBI:6835) has role insecticide (CHEBI:24852) |
| methomyl (CHEBI:6835) has role nematicide (CHEBI:25491) |
| methomyl (CHEBI:6835) has role xenobiotic (CHEBI:35703) |
| methomyl (CHEBI:6835) is a aliphatic sulfide (CHEBI:22327) |
| methomyl (CHEBI:6835) is a carbamate ester (CHEBI:23003) |
| Incoming Relation(s) |
| thiodicarb (CHEBI:38548) has functional parent methomyl (CHEBI:6835) |
| IUPAC Name |
|---|
| methyl N-(methylcarbamoyloxy)ethanimidothioate |
| Synonyms | Source |
|---|---|
| Methomyl | KEGG COMPOUND |
| 1-(Methylthio)acetaldehyde O-methylcarbamoyloxime | ChemIDplus |
| 1-(Methylthio)ethylideneamino methylcarbamate | ChemIDplus |
| Lannate | ChemIDplus |
| N-(((methylamino)carbonyl)oxy)ethanimidothioic acid methyl ester | ChemIDplus |
| Methomyl lannate | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042050 | Reaxys |
| CAS:16752-77-5 | KEGG COMPOUND |
| CAS:16752-77-5 | ChemIDplus |
| CAS:16752-77-5 | NIST Chemistry WebBook |
| Citations |
|---|