EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6835 - methomyl
| Formula | C5H10N2O2S |
| Net Charge | 0 |
| Average Mass | 162.214 |
| Monoisotopic Mass | 162.04630 |
| SMILES | CNC(=O)ON=C(C)SC |
| InChI | InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8) |
| InChIKey | UHXUZOCRWCRNSJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methomyl (CHEBI:6835) has functional parent 1-(methylsulfanyl)acetaldoxime (CHEBI:38534) |
| methomyl (CHEBI:6835) has functional parent methylcarbamic acid (CHEBI:45379) |
| methomyl (CHEBI:6835) has role acaricide (CHEBI:22153) |
| methomyl (CHEBI:6835) has role agrochemical (CHEBI:33286) |
| methomyl (CHEBI:6835) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| methomyl (CHEBI:6835) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| methomyl (CHEBI:6835) has role environmental contaminant (CHEBI:78298) |
| methomyl (CHEBI:6835) has role insecticide (CHEBI:24852) |
| methomyl (CHEBI:6835) has role nematicide (CHEBI:25491) |
| methomyl (CHEBI:6835) has role xenobiotic (CHEBI:35703) |
| methomyl (CHEBI:6835) is a aliphatic sulfide (CHEBI:22327) |
| methomyl (CHEBI:6835) is a carbamate ester (CHEBI:23003) |
| Incoming Relation(s) |
| thiodicarb (CHEBI:38548) has functional parent methomyl (CHEBI:6835) |
| IUPAC Name |
|---|
| methyl N-(methylcarbamoyloxy)ethanimidothioate |
| Synonyms | Source |
|---|---|
| Methomyl | KEGG COMPOUND |
| 1-(Methylthio)acetaldehyde O-methylcarbamoyloxime | ChemIDplus |
| 1-(Methylthio)ethylideneamino methylcarbamate | ChemIDplus |
| Lannate | ChemIDplus |
| N-(((methylamino)carbonyl)oxy)ethanimidothioic acid methyl ester | ChemIDplus |
| Methomyl lannate | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042050 | Reaxys |
| CAS:16752-77-5 | KEGG COMPOUND |
| CAS:16752-77-5 | ChemIDplus |
| CAS:16752-77-5 | NIST Chemistry WebBook |
| Citations |
|---|