EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | COc1c(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO[C@@H]4O[C@@H](CO)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c2c1=O |
| InChI | InChI=1S/C27H30O15/c1-37-25-20(33)17-13(30)6-12(7-14(17)40-24(25)10-2-4-11(29)5-3-10)39-27-23(36)21(34)19(32)16(42-27)9-38-26-22(35)18(31)15(8-28)41-26/h2-7,15-16,18-19,21-23,26-32,34-36H,8-9H2,1H3/t15-,16+,18-,19+,21-,22+,23+,26+,27+/m0/s1 |
| InChIKey | CKDKWYQPVPNIAZ-SLJRIFGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4',5,7-trihydroxy-3-methoxyflavone-7-O-α-L-arabinofuranosyl(1→6)-β-D-glucopyranoside (CHEBI:68348) has role metabolite (CHEBI:25212) |
| 4',5,7-trihydroxy-3-methoxyflavone-7-O-α-L-arabinofuranosyl(1→6)-β-D-glucopyranoside (CHEBI:68348) is a dihydroxyflavone (CHEBI:38686) |
| 4',5,7-trihydroxy-3-methoxyflavone-7-O-α-L-arabinofuranosyl(1→6)-β-D-glucopyranoside (CHEBI:68348) is a disaccharide derivative (CHEBI:63353) |
| 4',5,7-trihydroxy-3-methoxyflavone-7-O-α-L-arabinofuranosyl(1→6)-β-D-glucopyranoside (CHEBI:68348) is a glycosyloxyflavone (CHEBI:50018) |
| 4',5,7-trihydroxy-3-methoxyflavone-7-O-α-L-arabinofuranosyl(1→6)-β-D-glucopyranoside (CHEBI:68348) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-3-methoxy-4-oxo-4H-chromen-7-yl 6-O-α-L-arabinofuranosyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21301586 | Reaxys |
| Citations |
|---|