EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68346 - arauridine
| Formula | C9H12N2O6 |
| Net Charge | 0 |
| Average Mass | 244.203 |
| Monoisotopic Mass | 244.06954 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | DRTQHJPVMGBUCF-CCXZUQQUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arauridine (CHEBI:68346) has role metabolite (CHEBI:25212) |
| arauridine (CHEBI:68346) is a N-glycosyl compound (CHEBI:21731) |
| Synonyms | Source |
|---|---|
| Uracil, 1-beta-D-arabinofuranosyl- | ChEBI |
| 2,4(1H,3H)-Pyrimidinedione, 1-beta-D-arabinofuranosyl- | ChEBI |
| Spongouridine | ChEBI |
| Citations |
|---|