EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O9 |
| Net Charge | 0 |
| Average Mass | 346.332 |
| Monoisotopic Mass | 346.12638 |
| SMILES | COc1cc(CO)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22O9/c1-21-8-3-7(5-16)4-9(22-2)14(8)24-15-13(20)12(19)11(18)10(6-17)23-15/h3-4,10-13,15-20H,5-6H2,1-2H3/t10-,11-,12+,13-,15+/m1/s1 |
| InChIKey | RWIINOLFQCPJMH-VVSAWPALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Acer saccharum (ncbitaxon:4024) | bark (BTO:0001301) | PubMed (22032697) | The air-dried powder of the bark was extracted by maceration with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) has role antineoplastic agent (CHEBI:35610) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) has role metabolite (CHEBI:25212) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) is a aromatic ether (CHEBI:35618) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) is a benzyl alcohols (CHEBI:22743) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) is a monosaccharide derivative (CHEBI:63367) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) is a primary alcohol (CHEBI:15734) |
| 3,5-dimethoxy-4-hydroxybenzyl alcohol-4-O-β-D-glucopyranoside (CHEBI:68338) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)-2,6-dimethoxyphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1401009 | Reaxys |
| Citations |
|---|