EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O8 |
| Net Charge | 0 |
| Average Mass | 302.279 |
| Monoisotopic Mass | 302.10017 |
| SMILES | COc1cc(O)ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18O8/c1-19-8-4-6(15)2-3-7(8)20-13-12(18)11(17)10(16)9(5-14)21-13/h2-4,9-18H,5H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | LWEHRPZXRYZMDC-UJPOAAIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-methoxyphenyl 1-O-β-D-glucopyranoside (CHEBI:68337) has role metabolite (CHEBI:25212) |
| 4-hydroxy-2-methoxyphenyl 1-O-β-D-glucopyranoside (CHEBI:68337) is a aromatic ether (CHEBI:35618) |
| 4-hydroxy-2-methoxyphenyl 1-O-β-D-glucopyranoside (CHEBI:68337) is a monosaccharide derivative (CHEBI:63367) |
| 4-hydroxy-2-methoxyphenyl 1-O-β-D-glucopyranoside (CHEBI:68337) is a phenols (CHEBI:33853) |
| 4-hydroxy-2-methoxyphenyl 1-O-β-D-glucopyranoside (CHEBI:68337) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-hydroxy-2-methoxyphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:36597 | Reaxys |
| Citations |
|---|