EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1ccc2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-2-3-14-23(8-13)41-29(12-6-20(36)26(39)21(37)7-12)27(40)24(14)25-19(35)10-17(33)15-9-22(38)28(42-30(15)25)11-1-4-16(32)18(34)5-11/h1-8,10,22,24,27-29,31-40H,9H2/t22-,24+,27+,28+,29+/m0/s1 |
| InChIKey | XTVOPCAOTUZWHN-FNIOIVQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epirobinetinidol-(4β,8)-catechin (CHEBI:68336) has functional parent (+)-catechin (CHEBI:15600) |
| epirobinetinidol-(4β,8)-catechin (CHEBI:68336) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| epirobinetinidol-(4β,8)-catechin (CHEBI:68336) has role metabolite (CHEBI:25212) |
| epirobinetinidol-(4β,8)-catechin (CHEBI:68336) is a hydroxyflavan (CHEBI:72010) |
| epirobinetinidol-(4β,8)-catechin (CHEBI:68336) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2R,2'R,3R,3'S,4R)-2'-(3,4-dihydroxyphenyl)-2-(3,4,5-trihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5',7,7'-pentol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21299010 | Reaxys |
| Citations |
|---|