EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H5Br5O2 |
| Net Charge | 0 |
| Average Mass | 580.690 |
| Monoisotopic Mass | 575.62064 |
| SMILES | Oc1cc(Br)c(Br)c(Br)c1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H5Br5O2/c13-5-1-2-9(6(14)3-5)19-12-8(18)4-7(15)10(16)11(12)17/h1-4,18H |
| InChIKey | LNZHBUPVHNJGJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea (ncbitaxon:190526) | - | PubMed (21214221) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. calcium channel modulator A membrane transport modulator that is able to regulate intracellular calcium levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol (CHEBI:68326) has role calcium channel modulator (CHEBI:38808) |
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol (CHEBI:68326) has role metabolite (CHEBI:25212) |
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol (CHEBI:68326) is a aromatic ether (CHEBI:35618) |
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol (CHEBI:68326) is a organobromine compound (CHEBI:37141) |
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol (CHEBI:68326) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3,4,5-tribromo-2-(2,4-dibromophenoxy)phenol |
| Synonym | Source |
|---|---|
| 6-hydroxy-2,2',3,4,4'-pentabromodiphenyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2009924 | Reaxys |
| Citations |
|---|