EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H26Br6N4O8 |
| Net Charge | 0 |
| Average Mass | 1098.026 |
| Monoisotopic Mass | 1091.68509 |
| SMILES | O=C1NCCc2ccc(c(O)c2Br)Oc2c(Br)ccc(c2Br)CCNC(=O)/C(=N/O)Cc2cc(Br)c(O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O |
| InChI | InChI=1S/C34H26Br6N4O8/c35-19-3-1-18-6-8-42-34(48)24(44-50)13-16-9-20(36)29(45)26(14-16)52-31-21(37)10-15(11-22(31)38)12-23(43-49)33(47)41-7-5-17-2-4-25(30(46)27(17)39)51-32(19)28(18)40/h1-4,9-11,14,45-46,49-50H,5-8,12-13H2,(H,41,47)(H,42,48)/b43-23+,44-24+ |
| InChIKey | PKTKAHOYUVDXHU-ADHDEERNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ianthella (ncbitaxon:375145) | - | PubMed (21214221) |
| Roles Classification |
|---|
| Biological Roles: | calcium channel modulator A membrane transport modulator that is able to regulate intracellular calcium levels. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bastadin 6 (CHEBI:68324) has role calcium channel modulator (CHEBI:38808) |
| bastadin 6 (CHEBI:68324) has role metabolite (CHEBI:25212) |
| bastadin 6 (CHEBI:68324) is a cyclic ether (CHEBI:37407) |
| bastadin 6 (CHEBI:68324) is a ketoxime (CHEBI:24983) |
| bastadin 6 (CHEBI:68324) is a lactam (CHEBI:24995) |
| bastadin 6 (CHEBI:68324) is a macrocycle (CHEBI:51026) |
| bastadin 6 (CHEBI:68324) is a organobromine compound (CHEBI:37141) |
| bastadin 6 (CHEBI:68324) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (12E,25E)-4,16,21,31,36,38-hexabromo-17,32-dihydroxy-12,25-bis(hydroxyimino)-2,19-dioxa-10,27-diazapentacyclo[28.2.2.220,23.13,7.114,18]octatriaconta-1(32),3(38),4,6,14(37),15,17,20,22,30,33,35-dodecaene-11,26-dione |
| Synonym | Source |
|---|---|
| bastadin-6 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4226682 | Reaxys |
| Citations |
|---|