EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H27Br5N4O8 |
| Net Charge | 0 |
| Average Mass | 1019.130 |
| Monoisotopic Mass | 1013.77457 |
| SMILES | O=C1NCCc2ccc(c(Br)c2)Oc2cc(cc(Br)c2O)CCNC(=O)/C(=N/O)Cc2cc(Br)c(O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O |
| InChI | InChI=1S/C34H27Br5N4O8/c35-20-7-16-1-2-27(20)50-28-14-17(8-21(36)30(28)44)4-6-41-34(47)26(43-49)13-19-9-22(37)31(45)29(15-19)51-32-23(38)10-18(11-24(32)39)12-25(42-48)33(46)40-5-3-16/h1-2,7-11,14-15,44-45,48-49H,3-6,12-13H2,(H,40,46)(H,41,47)/b42-25+,43-26+ |
| InChIKey | AHBBQQLIUBAPCY-DCRHPOARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ianthella (ncbitaxon:375145) | - | PubMed (21214221) |
| Roles Classification |
|---|
| Biological Roles: | calcium channel modulator A membrane transport modulator that is able to regulate intracellular calcium levels. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-bastadin 19 (CHEBI:68321) has role calcium channel modulator (CHEBI:38808) |
| (E,E)-bastadin 19 (CHEBI:68321) has role metabolite (CHEBI:25212) |
| (E,E)-bastadin 19 (CHEBI:68321) is a cyclic ether (CHEBI:37407) |
| (E,E)-bastadin 19 (CHEBI:68321) is a ketoxime (CHEBI:24983) |
| (E,E)-bastadin 19 (CHEBI:68321) is a lactam (CHEBI:24995) |
| (E,E)-bastadin 19 (CHEBI:68321) is a macrocycle (CHEBI:51026) |
| (E,E)-bastadin 19 (CHEBI:68321) is a organobromine compound (CHEBI:37141) |
| (E,E)-bastadin 19 (CHEBI:68321) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (12E,25E)-5,16,21,32,36-pentabromo-4,17-dihydroxy-12,25-bis(hydroxyimino)-2,19-dioxa-10,27-diazapentacyclo[28.2.2.220,23.13,7.114,18]octatriaconta-1(32),3(38),4,6,14(37),15,17,20,22,30,33,35-dodecaene-11,26-dione |
| Synonym | Source |
|---|---|
| bastadin-19 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7406357 | Reaxys |
| Citations |
|---|