EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H27Br5N4O8 |
| Net Charge | 0 |
| Average Mass | 1019.130 |
| Monoisotopic Mass | 1013.77457 |
| SMILES | O=C1NCCc2ccc(c(Br)c2)Oc2cc(cc(Br)c2O)CCNC(=O)/C(=N/O)Cc2cc(Br)c(O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O |
| InChI | InChI=1S/C34H27Br5N4O8/c35-20-7-16-1-2-27(20)50-28-14-17(8-21(36)30(28)44)4-6-41-34(47)26(43-49)13-19-9-22(37)31(45)29(15-19)51-32-23(38)10-18(11-24(32)39)12-25(42-48)33(46)40-5-3-16/h1-2,7-11,14-15,44-45,48-49H,3-6,12-13H2,(H,40,46)(H,41,47)/b42-25+,43-26+ |
| InChIKey | AHBBQQLIUBAPCY-DCRHPOARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ianthella (ncbitaxon:375145) | - | PubMed (21214221) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. calcium channel modulator A membrane transport modulator that is able to regulate intracellular calcium levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-bastadin 19 (CHEBI:68321) has role calcium channel modulator (CHEBI:38808) |
| (E,E)-bastadin 19 (CHEBI:68321) has role metabolite (CHEBI:25212) |
| (E,E)-bastadin 19 (CHEBI:68321) is a cyclic ether (CHEBI:37407) |
| (E,E)-bastadin 19 (CHEBI:68321) is a ketoxime (CHEBI:24983) |
| (E,E)-bastadin 19 (CHEBI:68321) is a lactam (CHEBI:24995) |
| (E,E)-bastadin 19 (CHEBI:68321) is a macrocycle (CHEBI:51026) |
| (E,E)-bastadin 19 (CHEBI:68321) is a organobromine compound (CHEBI:37141) |
| (E,E)-bastadin 19 (CHEBI:68321) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (12E,25E)-5,16,21,32,36-pentabromo-4,17-dihydroxy-12,25-bis(hydroxyimino)-2,19-dioxa-10,27-diazapentacyclo[28.2.2.220,23.13,7.114,18]octatriaconta-1(32),3(38),4,6,14(37),15,17,20,22,30,33,35-dodecaene-11,26-dione |
| Synonym | Source |
|---|---|
| bastadin-19 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7406357 | Reaxys |
| Citations |
|---|