EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3.C2HF3O2 |
| Net Charge | 0 |
| Average Mass | 401.381 |
| Monoisotopic Mass | 401.14501 |
| SMILES | O=C(O)C(F)(F)F.[H][C@]12C[C@@H](O)C=C[C@]13CCN(C)Cc1ccc(OC)c(c13)O2 |
| InChI | InChI=1S/C17H21NO3.C2HF3O2/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;3-2(4,5)1(6)7/h3-6,12,14,19H,7-10H2,1-2H3;(H,6,7)/t12-,14-,17-;/m0./s1 |
| InChIKey | OKIJTRLQTCZBFU-XPSHAMGMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crinum asiaticum var. sinicum (ncbitaxon:223245) | leaf (BTO:0000713) | PubMed (21314165) | 95% ethanolic extract of dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galanthamine Trifluoroacetic acid (CHEBI:68318) has role metabolite (CHEBI:25212) |
| galanthamine Trifluoroacetic acid (CHEBI:68318) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| (4aS,6R,8aS)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro(3a,3,2-ef)(2)benzazepin-6-ol Trifluoroacetic acid | ChEBI |
| Lycoremine Trifluoroacetic acid | ChEBI |
| Nivaline Trifluoroacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:357-70-0 | ChemIDplus |
| Citations |
|---|