EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3.C2HF3O2 |
| Net Charge | 0 |
| Average Mass | 385.338 |
| Monoisotopic Mass | 385.11371 |
| SMILES | O=C(O)C(F)(F)F.[H][C@]12C[C@@H](O)C=C[C@@]13CCN2Cc1cc2c(cc13)OCO2 |
| InChI | InChI=1S/C16H17NO3.C2HF3O2/c18-11-1-2-16-3-4-17(15(16)6-11)8-10-5-13-14(7-12(10)16)20-9-19-13;3-2(4,5)1(6)7/h1-2,5,7,11,15,18H,3-4,6,8-9H2;(H,6,7)/t11-,15-,16-;/m0./s1 |
| InChIKey | RNFWKMVEAZEOII-SMUSPENPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crinum asiaticum var. sinicum (ncbitaxon:223245) | leaf (BTO:0000713) | PubMed (21314165) | 95% ethanolic extract of dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epivittatine Trifluoroacetic acid (CHEBI:68311) has role metabolite (CHEBI:25212) |
| epivittatine Trifluoroacetic acid (CHEBI:68311) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|