EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO3.C2HF3O2 |
| Net Charge | 0 |
| Average Mass | 387.354 |
| Monoisotopic Mass | 387.12936 |
| SMILES | O=C(O)C(F)(F)F.[H][C@]12C[C@@H](O)C=C[C@]13CCNCc1ccc(OC)c(c13)O2 |
| InChI | InChI=1S/C16H19NO3.C2HF3O2/c1-19-12-3-2-10-9-17-7-6-16-5-4-11(18)8-13(16)20-15(12)14(10)16;3-2(4,5)1(6)7/h2-5,11,13,17-18H,6-9H2,1H3;(H,6,7)/t11-,13-,16-;/m0./s1 |
| InChIKey | RKROJJLKVZAERI-OYAYLOLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crinum asiaticum var. sinicum (ncbitaxon:223245) | leaf (BTO:0000713) | PubMed (21314165) | 95% ethanolic extract of dried, powdered leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norgalanthamine Trifluoroacetic acid (CHEBI:68305) has role metabolite (CHEBI:25212) |
| norgalanthamine Trifluoroacetic acid (CHEBI:68305) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Galanthamine,10-demethyl- Trifluoroacetic acid | ChEBI |
| Citations |
|---|