EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24O10 |
| Net Charge | 0 |
| Average Mass | 544.512 |
| Monoisotopic Mass | 544.13695 |
| SMILES | Cc1cc2c(c(O)c1-c1c(C)cc3c(c1O)C(=O)C1=C(O)C=C[C@H](O)[C@]1(C)O3)C(=O)C1=C(O)C=CC(=O)[C@]1(C)O2 |
| InChI | InChI=1S/C30H24O10/c1-11-9-15-21(27(37)23-13(31)5-7-17(33)29(23,3)39-15)25(35)19(11)20-12(2)10-16-22(26(20)36)28(38)24-14(32)6-8-18(34)30(24,4)40-16/h5-10,17,31-33,35-36H,1-4H3/t17-,29-,30-/m0/s1 |
| InChIKey | DRYAIORIKWDUCC-AHFZSLFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | mycelium (BTO:0001436) | PubMed (21247198) | crude EtOAc extract of white mycelia isolated on the undersurface of a dead hardwood Strain: MYC 1734 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomalevone C (CHEBI:68299) has role antibacterial agent (CHEBI:33282) |
| phomalevone C (CHEBI:68299) has role fungal metabolite (CHEBI:76946) |
| phomalevone C (CHEBI:68299) is a biaryl (CHEBI:64459) |
| phomalevone C (CHEBI:68299) is a polyketide (CHEBI:26188) |
| phomalevone C (CHEBI:68299) is a polyphenol (CHEBI:26195) |
| phomalevone C (CHEBI:68299) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (5'S,10aR,10a'R)-1,1',5',8,8'-pentahydroxy-3,3',10a,10a'-tetramethyl-5',10a'-dihydro-9H,9'H-2,2'-bixanthene-5,9,9'(10aH)-trione |
| Manual Xrefs | Databases |
|---|---|
| 26346248 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21389532 | Reaxys |
| Citations |
|---|