EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O10 |
| Net Charge | 0 |
| Average Mass | 546.528 |
| Monoisotopic Mass | 546.15260 |
| SMILES | Cc1c(O)ccc(O)c1C(=O)c1c(O)cc(C)c(-c2c(C)cc(O)c(C(=O)c3c(O)ccc(O)c3C)c2O)c1O |
| InChI | InChI=1S/C30H26O10/c1-11-9-19(35)25(29(39)23-13(3)15(31)5-7-17(23)33)27(37)21(11)22-12(2)10-20(36)26(28(22)38)30(40)24-14(4)16(32)6-8-18(24)34/h5-10,31-38H,1-4H3 |
| InChIKey | QNGZXAWVLALWLX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | mycelium (BTO:0001436) | PubMed (21247198) | crude EtOAc extract of white mycelia isolated on the undersurface of a dead hardwood Strain: MYC 1734 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomalevone B (CHEBI:68298) has role antibacterial agent (CHEBI:33282) |
| phomalevone B (CHEBI:68298) has role antifungal agent (CHEBI:35718) |
| phomalevone B (CHEBI:68298) has role fungal metabolite (CHEBI:76946) |
| phomalevone B (CHEBI:68298) is a biphenyls (CHEBI:22888) |
| phomalevone B (CHEBI:68298) is a polyketide (CHEBI:26188) |
| phomalevone B (CHEBI:68298) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2,2',4,4'-tetrahydroxy-6,6'-dimethylbiphenyl-3,3'-diyl)bis[(3,6-dihydroxy-2-methylphenyl)methanone] |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21389533 | Reaxys |
| Citations |
|---|