EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O10 |
| Net Charge | 0 |
| Average Mass | 546.528 |
| Monoisotopic Mass | 546.15260 |
| SMILES | Cc1c(O)ccc(O)c1C(=O)c1c(O)cc(C)c(-c2c(C)cc(O)c(C(=O)c3c(O)ccc(O)c3C)c2O)c1O |
| InChI | InChI=1S/C30H26O10/c1-11-9-19(35)25(29(39)23-13(3)15(31)5-7-17(23)33)27(37)21(11)22-12(2)10-20(36)26(28(22)38)30(40)24-14(4)16(32)6-8-18(24)34/h5-10,31-38H,1-4H3 |
| InChIKey | QNGZXAWVLALWLX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | mycelium (BTO:0001436) | PubMed (21247198) | crude EtOAc extract of white mycelia isolated on the undersurface of a dead hardwood Strain: MYC 1734 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomalevone B (CHEBI:68298) has role antibacterial agent (CHEBI:33282) |
| phomalevone B (CHEBI:68298) has role antifungal agent (CHEBI:35718) |
| phomalevone B (CHEBI:68298) has role fungal metabolite (CHEBI:76946) |
| phomalevone B (CHEBI:68298) is a biphenyls (CHEBI:22888) |
| phomalevone B (CHEBI:68298) is a polyketide (CHEBI:26188) |
| phomalevone B (CHEBI:68298) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2,2',4,4'-tetrahydroxy-6,6'-dimethylbiphenyl-3,3'-diyl)bis[(3,6-dihydroxy-2-methylphenyl)methanone] |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21389533 | Reaxys |
| Citations |
|---|